C23H32N4O6 — CID 154921563
2-[4-[1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]imidazol-2-yl]phenoxy]acetamide;formic acid (PubChem CID 154921563) has the molecular formula C23H32N4O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-[4-[1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]imidazol-2-yl]phenoxy]acetamide;formic acid.
| Compound Name | 2-[4-[1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]imidazol-2-yl]phenoxy]acetamide;formic acid |
|---|---|
| PubChem CID | 154921563 |
| Molecular Formula | C23H32N4O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 2-[4-[1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]imidazol-2-yl]phenoxy]acetamide;formic acid |
| SMILES | NC(=O)COc1ccc(-c2nccn2C[C@@H]2CCCN3CCCC[C@H]23)cc1.O=CO.O=CO |
| InChI | InChI=1S/C21H28N4O2.2CH2O2/c22-20(26)15-27-18-8-6-16(7-9-18)21-23-10-13-25(21)14-17-4-3-12-24-11-2-1-5-19(17)24;2*2-1-3/h6-10,13,17,19H,1-5,11-12,14-15H2,(H2,22,26);2*1H,(H,2,3)/t17-,19+;;/m0../s1 |
| InChIKey | HGGWRFQPKVSTHM-UKWJXJBFSA-N |
| XLogP | 2.08 |
| TPSA | 147.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|