C18H25N5O2 — CID 154922649
(1S,9aR)-1-[(2-pyrimidin-5-ylimidazol-1-yl)methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;formic acid (PubChem CID 154922649) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (1S,9aR)-1-[(2-pyrimidin-5-ylimidazol-1-yl)methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;formic acid.
| Compound Name | (1S,9aR)-1-[(2-pyrimidin-5-ylimidazol-1-yl)methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;formic acid |
|---|---|
| PubChem CID | 154922649 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | (1S,9aR)-1-[(2-pyrimidin-5-ylimidazol-1-yl)methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;formic acid |
| SMILES | O=CO.c1ncc(-c2nccn2C[C@@H]2CCCN3CCCC[C@H]23)cn1 |
| InChI | InChI=1S/C17H23N5.CH2O2/c1-2-7-21-8-3-4-14(16(21)5-1)12-22-9-6-20-17(22)15-10-18-13-19-11-15;2-1-3/h6,9-11,13-14,16H,1-5,7-8,12H2;1H,(H,2,3)/t14-,16+;/m0./s1 |
| InChIKey | YQDJXTRTCXAKQK-KUARMEPBSA-N |
| XLogP | 2.31 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|