C13H18N4O2S — CID 155971731
formic acid;2-[1-[(1-methylpyrrolidin-3-yl)methyl]imidazol-2-yl]-1,3-thiazole (PubChem CID 155971731) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is formic acid;2-[1-[(1-methylpyrrolidin-3-yl)methyl]imidazol-2-yl]-1,3-thiazole.
| Compound Name | formic acid;2-[1-[(1-methylpyrrolidin-3-yl)methyl]imidazol-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 155971731 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | formic acid;2-[1-[(1-methylpyrrolidin-3-yl)methyl]imidazol-2-yl]-1,3-thiazole |
| SMILES | CN1CCC(Cn2ccnc2-c2nccs2)C1.O=CO |
| InChI | InChI=1S/C12H16N4S.CH2O2/c1-15-5-2-10(8-15)9-16-6-3-13-11(16)12-14-4-7-17-12;2-1-3/h3-4,6-7,10H,2,5,8-9H2,1H3;1H,(H,2,3) |
| InChIKey | BVLVZYPPAUBVMW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|