C20H24N6 — CID 95555822
N-benzyl-5-[1-[[(3S)-1-methylpyrrolidin-3-yl]methyl]imidazol-2-yl]pyrimidin-2-amine (PubChem CID 95555822) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-benzyl-5-[1-[[(3S)-1-methylpyrrolidin-3-yl]methyl]imidazol-2-yl]pyrimidin-2-amine.
| Compound Name | N-benzyl-5-[1-[[(3S)-1-methylpyrrolidin-3-yl]methyl]imidazol-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 95555822 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | N-benzyl-5-[1-[[(3S)-1-methylpyrrolidin-3-yl]methyl]imidazol-2-yl]pyrimidin-2-amine |
| SMILES | CN1CC[C@H](Cn2ccnc2-c2cnc(NCc3ccccc3)nc2)C1 |
| InChI | InChI=1S/C20H24N6/c1-25-9-7-17(14-25)15-26-10-8-21-19(26)18-12-23-20(24-13-18)22-11-16-5-3-2-4-6-16/h2-6,8,10,12-13,17H,7,9,11,14-15H2,1H3,(H,22,23,24)/t17-/m0/s1 |
| InChIKey | JXDPSUYHKHVEDA-KRWDZBQOSA-N |
| XLogP | 2.90 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |