C22H27N5O3 — CID 171325246
N-benzyl-5-[1-(4-methoxycyclohexyl)imidazol-2-yl]pyrimidin-2-amine;formic acid (PubChem CID 171325246) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-benzyl-5-[1-(4-methoxycyclohexyl)imidazol-2-yl]pyrimidin-2-amine;formic acid.
| Compound Name | N-benzyl-5-[1-(4-methoxycyclohexyl)imidazol-2-yl]pyrimidin-2-amine;formic acid |
|---|---|
| PubChem CID | 171325246 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | N-benzyl-5-[1-(4-methoxycyclohexyl)imidazol-2-yl]pyrimidin-2-amine;formic acid |
| SMILES | COC1CCC(n2ccnc2-c2cnc(NCc3ccccc3)nc2)CC1.O=CO |
| InChI | InChI=1S/C21H25N5O.CH2O2/c1-27-19-9-7-18(8-10-19)26-12-11-22-20(26)17-14-24-21(25-15-17)23-13-16-5-3-2-4-6-16;2-1-3/h2-6,11-12,14-15,18-19H,7-10,13H2,1H3,(H,23,24,25);1H,(H,2,3) |
| InChIKey | LTWFWYMUNSTNLT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|