C12H22N4 — CID 106563035
1-[(1-methylpyrrolidin-3-yl)methyl]-N-propan-2-ylimidazol-2-amine (PubChem CID 106563035) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 1-[(1-methylpyrrolidin-3-yl)methyl]-N-propan-2-ylimidazol-2-amine.
| Compound Name | 1-[(1-methylpyrrolidin-3-yl)methyl]-N-propan-2-ylimidazol-2-amine |
|---|---|
| PubChem CID | 106563035 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 1-[(1-methylpyrrolidin-3-yl)methyl]-N-propan-2-ylimidazol-2-amine |
| SMILES | CC(C)Nc1nccn1CC1CCN(C)C1 |
| InChI | InChI=1S/C12H22N4/c1-10(2)14-12-13-5-7-16(12)9-11-4-6-15(3)8-11/h5,7,10-11H,4,6,8-9H2,1-3H3,(H,13,14) |
| InChIKey | RQWSLFCHOQHVCW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |