C20H31N5 — CID 154567840
(1S,9aR)-1-[2-[2-(1,4,5-trimethylimidazol-2-yl)imidazol-1-yl]ethyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 154567840) has the molecular formula C20H31N5 and a molecular weight of 341.50 g/mol. Its IUPAC name is (1S,9aR)-1-[2-[2-(1,4,5-trimethylimidazol-2-yl)imidazol-1-yl]ethyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | (1S,9aR)-1-[2-[2-(1,4,5-trimethylimidazol-2-yl)imidazol-1-yl]ethyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 154567840 |
| Molecular Formula | C20H31N5 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | (1S,9aR)-1-[2-[2-(1,4,5-trimethylimidazol-2-yl)imidazol-1-yl]ethyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | Cc1nc(-c2nccn2CC[C@@H]2CCCN3CCCC[C@H]23)n(C)c1C |
| InChI | InChI=1S/C20H31N5/c1-15-16(2)23(3)20(22-15)19-21-10-14-25(19)13-9-17-7-6-12-24-11-5-4-8-18(17)24/h10,14,17-18H,4-9,11-13H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | AZCZOVQJNZNWFM-ZWKOTPCHSA-N |
| XLogP | 3.56 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |