C20H38FN3O5 — CID 154921836
[4-(5-fluoropentyl)-1,4-diazepan-1-yl]-(1-methylazepan-2-yl)methanone;formic acid (PubChem CID 154921836) has the molecular formula C20H38FN3O5 and a molecular weight of 419.54 g/mol. Its IUPAC name is [4-(5-fluoropentyl)-1,4-diazepan-1-yl]-(1-methylazepan-2-yl)methanone;formic acid.
| Compound Name | [4-(5-fluoropentyl)-1,4-diazepan-1-yl]-(1-methylazepan-2-yl)methanone;formic acid |
|---|---|
| PubChem CID | 154921836 |
| Molecular Formula | C20H38FN3O5 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | [4-(5-fluoropentyl)-1,4-diazepan-1-yl]-(1-methylazepan-2-yl)methanone;formic acid |
| SMILES | CN1CCCCCC1C(=O)N1CCCN(CCCCCF)CC1.O=CO.O=CO |
| InChI | InChI=1S/C18H34FN3O.2CH2O2/c1-20-11-6-2-4-9-17(20)18(23)22-14-8-13-21(15-16-22)12-7-3-5-10-19;2*2-1-3/h17H,2-16H2,1H3;2*1H,(H,2,3) |
| InChIKey | FKFOSONJVNNSJX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|