C16H31N3O2 — CID 62907208
[4-(5-aminopentyl)-1,4-diazepan-1-yl]-(oxan-4-yl)methanone (PubChem CID 62907208) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is [4-(5-aminopentyl)-1,4-diazepan-1-yl]-(oxan-4-yl)methanone.
| Compound Name | [4-(5-aminopentyl)-1,4-diazepan-1-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 62907208 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | [4-(5-aminopentyl)-1,4-diazepan-1-yl]-(oxan-4-yl)methanone |
| SMILES | NCCCCCN1CCCN(C(=O)C2CCOCC2)CC1 |
| InChI | InChI=1S/C16H31N3O2/c17-7-2-1-3-8-18-9-4-10-19(12-11-18)16(20)15-5-13-21-14-6-15/h15H,1-14,17H2 |
| InChIKey | BBDHFKYBQOVHTB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|