C22H39N3O5 — CID 154922413
N-[(1R,2R,5S)-5-(cyclobutylcarbamoyl)-2-propoxycyclohexyl]-1-methylpiperidine-4-carboxamide;formic acid (PubChem CID 154922413) has the molecular formula C22H39N3O5 and a molecular weight of 425.57 g/mol. Its IUPAC name is N-[(1R,2R,5S)-5-(cyclobutylcarbamoyl)-2-propoxycyclohexyl]-1-methylpiperidine-4-carboxamide;formic acid.
| Compound Name | N-[(1R,2R,5S)-5-(cyclobutylcarbamoyl)-2-propoxycyclohexyl]-1-methylpiperidine-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 154922413 |
| Molecular Formula | C22H39N3O5 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | N-[(1R,2R,5S)-5-(cyclobutylcarbamoyl)-2-propoxycyclohexyl]-1-methylpiperidine-4-carboxamide;formic acid |
| SMILES | CCCO[C@@H]1CC[C@H](C(=O)NC2CCC2)C[C@H]1NC(=O)C1CCN(C)CC1.O=CO |
| InChI | InChI=1S/C21H37N3O3.CH2O2/c1-3-13-27-19-8-7-16(21(26)22-17-5-4-6-17)14-18(19)23-20(25)15-9-11-24(2)12-10-15;2-1-3/h15-19H,3-14H2,1-2H3,(H,22,26)(H,23,25);1H,(H,2,3)/t16-,18+,19+;/m0./s1 |
| InChIKey | GLMUSYCNLCLNKC-MBHUSPCXSA-N |
| XLogP | 1.78 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|