About N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]azepane-4-carboxamide;hydrochloride
N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]azepane-4-carboxamide;hydrochloride (PubChem CID 154922617) has the molecular formula C13H22ClN3OS
and a molecular weight of 303.86 g/mol. Its IUPAC name is N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]azepane-4-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]azepane-4-carboxamide;hydrochloride |
| PubChem CID | 154922617 |
| Molecular Formula | C13H22ClN3OS |
| Molecular Weight | 303.86 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]azepane-4-carboxamide;hydrochloride |
| SMILES | Cc1csc(CN(C)C(=O)C2CCCNCC2)n1.Cl |
| InChI | InChI=1S/C13H21N3OS.ClH/c1-10-9-18-12(15-10)8-16(2)13(17)11-4-3-6-14-7-5-11;/h9,11,14H,3-8H2,1-2H3;1H |
| InChIKey | QCKNBLZBAQDCJP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.86 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]azepane-4-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]azepane-4-carboxamide;hydrochloride?
The IUPAC name of N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]azepane-4-carboxamide;hydrochloride (CID 154922617) is N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]azepane-4-carboxamide;hydrochloride.
What is the SMILES notation for N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]azepane-4-carboxamide;hydrochloride?
The canonical SMILES for N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]azepane-4-carboxamide;hydrochloride is Cc1csc(CN(C)C(=O)C2CCCNCC2)n1.Cl.
What is the InChIKey of N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]azepane-4-carboxamide;hydrochloride?
The InChIKey is QCKNBLZBAQDCJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3OS.ClH/c1-10-9-18-12(15-10)8-16(2)13(17)11-4-3-6-14-7-5-11;/h9,11,14H,3-8H2,1-2H3;1H.
What are the key properties of N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]azepane-4-carboxamide;hydrochloride?
N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]azepane-4-carboxamide;hydrochloride has a molecular weight of 303.86 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]azepane-4-carboxamide;hydrochloride is sourced from PubChem (CID 154922617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).