C21H26N4O4 — CID 154923830
3-[1-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]imidazol-2-yl]-7-methoxy-1H-quinolin-2-one;formic acid (PubChem CID 154923830) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-[1-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]imidazol-2-yl]-7-methoxy-1H-quinolin-2-one;formic acid.
| Compound Name | 3-[1-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]imidazol-2-yl]-7-methoxy-1H-quinolin-2-one;formic acid |
|---|---|
| PubChem CID | 154923830 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 3-[1-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]imidazol-2-yl]-7-methoxy-1H-quinolin-2-one;formic acid |
| SMILES | CCN1CCC[C@H]1Cn1ccnc1-c1cc2ccc(OC)cc2[nH]c1=O.O=CO |
| InChI | InChI=1S/C20H24N4O2.CH2O2/c1-3-23-9-4-5-15(23)13-24-10-8-21-19(24)17-11-14-6-7-16(26-2)12-18(14)22-20(17)25;2-1-3/h6-8,10-12,15H,3-5,9,13H2,1-2H3,(H,22,25);1H,(H,2,3)/t15-;/m0./s1 |
| InChIKey | IPISRSJRRZJBFI-RSAXXLAASA-N |
| XLogP | 2.59 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|