C16H17F3N2O2 — CID 95216039
7-methoxy-3-[[(2R)-2-(trifluoromethyl)pyrrolidin-1-yl]methyl]-1H-quinolin-2-one (PubChem CID 95216039) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is 7-methoxy-3-[[(2R)-2-(trifluoromethyl)pyrrolidin-1-yl]methyl]-1H-quinolin-2-one.
| Compound Name | 7-methoxy-3-[[(2R)-2-(trifluoromethyl)pyrrolidin-1-yl]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 95216039 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 7-methoxy-3-[[(2R)-2-(trifluoromethyl)pyrrolidin-1-yl]methyl]-1H-quinolin-2-one |
| SMILES | COc1ccc2cc(CN3CCC[C@@H]3C(F)(F)F)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C16H17F3N2O2/c1-23-12-5-4-10-7-11(15(22)20-13(10)8-12)9-21-6-2-3-14(21)16(17,18)19/h4-5,7-8,14H,2-3,6,9H2,1H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | BZTWRWPABHNHGJ-CQSZACIVSA-N |
| XLogP | 3.06 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |