C23H24N2O4 — CID 97209780
4-[(3S)-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]benzoic acid (PubChem CID 97209780) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 4-[(3S)-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]benzoic acid.
| Compound Name | 4-[(3S)-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 97209780 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-[(3S)-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]piperidin-3-yl]benzoic acid |
| SMILES | COc1ccc2cc(CN3CCC[C@@H](c4ccc(C(=O)O)cc4)C3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C23H24N2O4/c1-29-20-9-8-17-11-19(22(26)24-21(17)12-20)14-25-10-2-3-18(13-25)15-4-6-16(7-5-15)23(27)28/h4-9,11-12,18H,2-3,10,13-14H2,1H3,(H,24,26)(H,27,28)/t18-/m1/s1 |
| InChIKey | SUAQPHBYXWRYDZ-GOSISDBHSA-N |
| XLogP | 3.61 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |