C22H29N3O3 — CID 110363209
3-[[4-(cyclohexanecarbonyl)piperazin-1-yl]methyl]-7-methoxy-1H-quinolin-2-one (PubChem CID 110363209) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-[[4-(cyclohexanecarbonyl)piperazin-1-yl]methyl]-7-methoxy-1H-quinolin-2-one.
| Compound Name | 3-[[4-(cyclohexanecarbonyl)piperazin-1-yl]methyl]-7-methoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 110363209 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 3-[[4-(cyclohexanecarbonyl)piperazin-1-yl]methyl]-7-methoxy-1H-quinolin-2-one |
| SMILES | COc1ccc2cc(CN3CCN(C(=O)C4CCCCC4)CC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C22H29N3O3/c1-28-19-8-7-17-13-18(21(26)23-20(17)14-19)15-24-9-11-25(12-10-24)22(27)16-5-3-2-4-6-16/h7-8,13-14,16H,2-6,9-12,15H2,1H3,(H,23,26) |
| InChIKey | ZSETUBKBLSVIDT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |