C16H21ClN6O4 — CID 154923994
4-[4-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)-1,4-diazepan-1-yl]-1H-pyrimidin-6-one;formic acid (PubChem CID 154923994) has the molecular formula C16H21ClN6O4 and a molecular weight of 396.84 g/mol. Its IUPAC name is 4-[4-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)-1,4-diazepan-1-yl]-1H-pyrimidin-6-one;formic acid.
| Compound Name | 4-[4-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)-1,4-diazepan-1-yl]-1H-pyrimidin-6-one;formic acid |
|---|---|
| PubChem CID | 154923994 |
| Molecular Formula | C16H21ClN6O4 |
| Molecular Weight | 396.84 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 4-[4-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)-1,4-diazepan-1-yl]-1H-pyrimidin-6-one;formic acid |
| SMILES | Cc1c(Cl)c(C(=O)N2CCCN(c3cc(=O)[nH]cn3)CC2)nn1C.O=CO |
| InChI | InChI=1S/C15H19ClN6O2.CH2O2/c1-10-13(16)14(19-20(10)2)15(24)22-5-3-4-21(6-7-22)11-8-12(23)18-9-17-11;2-1-3/h8-9H,3-7H2,1-2H3,(H,17,18,23);1H,(H,2,3) |
| InChIKey | QEBCMGMDBFSINU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.84 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|