C16H22F3N3O4 — CID 154924322
N-[3-(pyridin-3-ylamino)propyl]oxane-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 154924322) has the molecular formula C16H22F3N3O4 and a molecular weight of 377.36 g/mol. Its IUPAC name is N-[3-(pyridin-3-ylamino)propyl]oxane-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[3-(pyridin-3-ylamino)propyl]oxane-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154924322 |
| Molecular Formula | C16H22F3N3O4 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[3-(pyridin-3-ylamino)propyl]oxane-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCCCNc1cccnc1)C1CCCCO1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21N3O2.C2HF3O2/c18-14(13-6-1-2-10-19-13)17-9-4-8-16-12-5-3-7-15-11-12;3-2(4,5)1(6)7/h3,5,7,11,13,16H,1-2,4,6,8-10H2,(H,17,18);(H,6,7) |
| InChIKey | KPJINOOSKNMNJF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|