C13H14F3N3O3 — CID 140628151
[(3S)-3-amino-2-oxo-1-pyridin-3-ylazepan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 140628151) has the molecular formula C13H14F3N3O3 and a molecular weight of 317.27 g/mol. Its IUPAC name is [(3S)-3-amino-2-oxo-1-pyridin-3-ylazepan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(3S)-3-amino-2-oxo-1-pyridin-3-ylazepan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140628151 |
| Molecular Formula | C13H14F3N3O3 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | [(3S)-3-amino-2-oxo-1-pyridin-3-ylazepan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | N[C@]1(OC(=O)C(F)(F)F)CCCCN(c2cccnc2)C1=O |
| InChI | InChI=1S/C13H14F3N3O3/c14-13(15,16)11(21)22-12(17)5-1-2-7-19(10(12)20)9-4-3-6-18-8-9/h3-4,6,8H,1-2,5,7,17H2/t12-/m0/s1 |
| InChIKey | LZSLSDHOPFFKNR-LBPRGKRZSA-N |
| XLogP | 1.36 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|