C21H26F6N6O5 — CID 154924774
N-(1,5-dimethyl-1,2,4-triazol-3-yl)-4-(2-methylphenyl)-1,4-diazepane-1-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 154924774) has the molecular formula C21H26F6N6O5 and a molecular weight of 556.46 g/mol. Its IUPAC name is N-(1,5-dimethyl-1,2,4-triazol-3-yl)-4-(2-methylphenyl)-1,4-diazepane-1-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-(1,5-dimethyl-1,2,4-triazol-3-yl)-4-(2-methylphenyl)-1,4-diazepane-1-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 154924774 |
| Molecular Formula | C21H26F6N6O5 |
| Molecular Weight | 556.46 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | N-(1,5-dimethyl-1,2,4-triazol-3-yl)-4-(2-methylphenyl)-1,4-diazepane-1-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccccc1N1CCCN(C(=O)Nc2nc(C)n(C)n2)CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N6O.2C2HF3O2/c1-13-7-4-5-8-15(13)22-9-6-10-23(12-11-22)17(24)19-16-18-14(2)21(3)20-16;2*3-2(4,5)1(6)7/h4-5,7-8H,6,9-12H2,1-3H3,(H,19,20,24);2*(H,6,7) |
| InChIKey | HTTMVARCSZZERL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 140.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |