About (2-chloropyrimidin-4-yl) 2-fluorobenzoate
(2-chloropyrimidin-4-yl) 2-fluorobenzoate (PubChem CID 154928170) has the molecular formula C11H6ClFN2O2
and a molecular weight of 252.63 g/mol. Its IUPAC name is (2-chloropyrimidin-4-yl) 2-fluorobenzoate.
Molecular Properties
| Compound Name | (2-chloropyrimidin-4-yl) 2-fluorobenzoate |
| PubChem CID | 154928170 |
| Molecular Formula | C11H6ClFN2O2 |
| Molecular Weight | 252.63 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | (2-chloropyrimidin-4-yl) 2-fluorobenzoate |
| SMILES | O=C(Oc1ccnc(Cl)n1)c1ccccc1F |
| InChI | InChI=1S/C11H6ClFN2O2/c12-11-14-6-5-9(15-11)17-10(16)7-3-1-2-4-8(7)13/h1-6H |
| InChIKey | HKJUNLAHQGIPGZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.63 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-chloropyrimidin-4-yl) 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloropyrimidin-4-yl) 2-fluorobenzoate?
The IUPAC name of (2-chloropyrimidin-4-yl) 2-fluorobenzoate (CID 154928170) is (2-chloropyrimidin-4-yl) 2-fluorobenzoate.
What is the SMILES notation for (2-chloropyrimidin-4-yl) 2-fluorobenzoate?
The canonical SMILES for (2-chloropyrimidin-4-yl) 2-fluorobenzoate is O=C(Oc1ccnc(Cl)n1)c1ccccc1F.
What is the InChIKey of (2-chloropyrimidin-4-yl) 2-fluorobenzoate?
The InChIKey is HKJUNLAHQGIPGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6ClFN2O2/c12-11-14-6-5-9(15-11)17-10(16)7-3-1-2-4-8(7)13/h1-6H.
What are the key properties of (2-chloropyrimidin-4-yl) 2-fluorobenzoate?
(2-chloropyrimidin-4-yl) 2-fluorobenzoate has a molecular weight of 252.63 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloropyrimidin-4-yl) 2-fluorobenzoate is sourced from PubChem (CID 154928170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).