C20H19F5N4O5S2 — CID 154928497
2-[2-(aminomethyl)-3,3-difluoroprop-2-enyl]-4-[[5-(4-methylsulfonylphenyl)thiophen-2-yl]methyl]-1,2,4-triazol-3-one;2,2,2-trifluoroacetic acid (PubChem CID 154928497) has the molecular formula C20H19F5N4O5S2 and a molecular weight of 554.52 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-3,3-difluoroprop-2-enyl]-4-[[5-(4-methylsulfonylphenyl)thiophen-2-yl]methyl]-1,2,4-triazol-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[2-(aminomethyl)-3,3-difluoroprop-2-enyl]-4-[[5-(4-methylsulfonylphenyl)thiophen-2-yl]methyl]-1,2,4-triazol-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154928497 |
| Molecular Formula | C20H19F5N4O5S2 |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 554.07 |
| IUPAC Name | 2-[2-(aminomethyl)-3,3-difluoroprop-2-enyl]-4-[[5-(4-methylsulfonylphenyl)thiophen-2-yl]methyl]-1,2,4-triazol-3-one;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(Cn3cnn(CC(CN)=C(F)F)c3=O)s2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H18F2N4O3S2.C2HF3O2/c1-29(26,27)15-5-2-12(3-6-15)16-7-4-14(28-16)10-23-11-22-24(18(23)25)9-13(8-21)17(19)20;3-2(4,5)1(6)7/h2-7,11H,8-10,21H2,1H3;(H,6,7) |
| InChIKey | PKPIETDNWDLJLB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 137.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |