C23H20F5N5O4S — CID 154983600
6-[5-[[1-[2-(aminomethyl)-3,3-difluoroprop-2-enyl]-5-oxo-1,2,4-triazol-4-yl]methyl]thiophen-2-yl]-8-methyl-1H-quinolin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 154983600) has the molecular formula C23H20F5N5O4S and a molecular weight of 557.50 g/mol. Its IUPAC name is 6-[5-[[1-[2-(aminomethyl)-3,3-difluoroprop-2-enyl]-5-oxo-1,2,4-triazol-4-yl]methyl]thiophen-2-yl]-8-methyl-1H-quinolin-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[5-[[1-[2-(aminomethyl)-3,3-difluoroprop-2-enyl]-5-oxo-1,2,4-triazol-4-yl]methyl]thiophen-2-yl]-8-methyl-1H-quinolin-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154983600 |
| Molecular Formula | C23H20F5N5O4S |
| Molecular Weight | 557.50 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | 6-[5-[[1-[2-(aminomethyl)-3,3-difluoroprop-2-enyl]-5-oxo-1,2,4-triazol-4-yl]methyl]thiophen-2-yl]-8-methyl-1H-quinolin-2-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(-c2ccc(Cn3cnn(CC(CN)=C(F)F)c3=O)s2)cc2ccc(=O)[nH]c12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H19F2N5O2S.C2HF3O2/c1-12-6-14(7-13-2-5-18(29)26-19(12)13)17-4-3-16(31-17)10-27-11-25-28(21(27)30)9-15(8-24)20(22)23;3-2(4,5)1(6)7/h2-7,11H,8-10,24H2,1H3,(H,26,29);(H,6,7) |
| InChIKey | QKYUWXBYFMEWIP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |