C29H27N7O — CID 154929808
(4-aminophenyl)-[3-[[4-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]methanone (PubChem CID 154929808) has the molecular formula C29H27N7O and a molecular weight of 489.58 g/mol. Its IUPAC name is (4-aminophenyl)-[3-[[4-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]methanone.
| Compound Name | (4-aminophenyl)-[3-[[4-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 154929808 |
| Molecular Formula | C29H27N7O |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | (4-aminophenyl)-[3-[[4-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)pyrimidin-2-yl]amino]piperidin-1-yl]methanone |
| SMILES | Nc1ccc(C(=O)N2CCCC(Nc3nccc(-c4c(-c5ccccc5)nn5ccccc45)n3)C2)cc1 |
| InChI | InChI=1S/C29H27N7O/c30-22-13-11-21(12-14-22)28(37)35-17-6-9-23(19-35)32-29-31-16-15-24(33-29)26-25-10-4-5-18-36(25)34-27(26)20-7-2-1-3-8-20/h1-5,7-8,10-16,18,23H,6,9,17,19,30H2,(H,31,32,33) |
| InChIKey | KRSORDSWIDEGEY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 101.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|