C17H29N3S — CID 154930205
[(Z,3E)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-3-ethylidene-4-methylhex-1-enyl]hydrazine (PubChem CID 154930205) has the molecular formula C17H29N3S and a molecular weight of 307.51 g/mol. Its IUPAC name is [(Z,3E)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-3-ethylidene-4-methylhex-1-enyl]hydrazine.
| Compound Name | [(Z,3E)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-3-ethylidene-4-methylhex-1-enyl]hydrazine |
|---|---|
| PubChem CID | 154930205 |
| Molecular Formula | C17H29N3S |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | [(Z,3E)-4-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-3-ethylidene-4-methylhex-1-enyl]hydrazine |
| SMILES | C/C=C(\C=C/NN)C(C)(CC)Cc1cnc(C(C)(C)C)s1 |
| InChI | InChI=1S/C17H29N3S/c1-7-13(9-10-20-18)17(6,8-2)11-14-12-19-15(21-14)16(3,4)5/h7,9-10,12,20H,8,11,18H2,1-6H3/b10-9-,13-7+ |
| InChIKey | ZEKMJCICLOWWIA-QLNUPNCESA-N |
| XLogP | 4.32 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|