C23H27NO — CID 154932148
N-cyclohexyl-N-[(3E)-4-(4-methoxyphenyl)buta-1,3-dien-2-yl]aniline (PubChem CID 154932148) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is N-cyclohexyl-N-[(3E)-4-(4-methoxyphenyl)buta-1,3-dien-2-yl]aniline.
| Compound Name | N-cyclohexyl-N-[(3E)-4-(4-methoxyphenyl)buta-1,3-dien-2-yl]aniline |
|---|---|
| PubChem CID | 154932148 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-cyclohexyl-N-[(3E)-4-(4-methoxyphenyl)buta-1,3-dien-2-yl]aniline |
| SMILES | C=C(/C=C/c1ccc(OC)cc1)N(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C23H27NO/c1-19(13-14-20-15-17-23(25-2)18-16-20)24(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3,5-6,9-10,13-18,22H,1,4,7-8,11-12H2,2H3/b14-13+ |
| InChIKey | SBSFODJTHAWWRL-BUHFOSPRSA-N |
| XLogP | 6.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|