C16H16BrF3N2O4 — CID 154932620
2-[6-bromo-2-(difluoromethyl)-8-fluoroquinazolin-4-yl]oxyethyl tert-butyl carbonate (PubChem CID 154932620) has the molecular formula C16H16BrF3N2O4 and a molecular weight of 437.21 g/mol. Its IUPAC name is 2-[6-bromo-2-(difluoromethyl)-8-fluoroquinazolin-4-yl]oxyethyl tert-butyl carbonate.
| Compound Name | 2-[6-bromo-2-(difluoromethyl)-8-fluoroquinazolin-4-yl]oxyethyl tert-butyl carbonate |
|---|---|
| PubChem CID | 154932620 |
| Molecular Formula | C16H16BrF3N2O4 |
| Molecular Weight | 437.21 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 2-[6-bromo-2-(difluoromethyl)-8-fluoroquinazolin-4-yl]oxyethyl tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)OCCOc1nc(C(F)F)nc2c(F)cc(Br)cc12 |
| InChI | InChI=1S/C16H16BrF3N2O4/c1-16(2,3)26-15(23)25-5-4-24-14-9-6-8(17)7-10(18)11(9)21-13(22-14)12(19)20/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | KOILDJDCFYUQNH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.21 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|