C16H21BrFN3O2 — CID 153446305
tert-butyl N-[(2R)-2-(6-bromo-4-fluoro-2-methylbenzimidazol-1-yl)propyl]carbamate (PubChem CID 153446305) has the molecular formula C16H21BrFN3O2 and a molecular weight of 386.27 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-(6-bromo-4-fluoro-2-methylbenzimidazol-1-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-(6-bromo-4-fluoro-2-methylbenzimidazol-1-yl)propyl]carbamate |
|---|---|
| PubChem CID | 153446305 |
| Molecular Formula | C16H21BrFN3O2 |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | tert-butyl N-[(2R)-2-(6-bromo-4-fluoro-2-methylbenzimidazol-1-yl)propyl]carbamate |
| SMILES | Cc1nc2c(F)cc(Br)cc2n1[C@H](C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21BrFN3O2/c1-9(8-19-15(22)23-16(3,4)5)21-10(2)20-14-12(18)6-11(17)7-13(14)21/h6-7,9H,8H2,1-5H3,(H,19,22)/t9-/m1/s1 |
| InChIKey | CJQILOALVDUMSY-SECBINFHSA-N |
| XLogP | 4.33 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |