C13H19F3N2O2 — CID 175520064
tert-butyl N-[(2R)-2-[2-(trifluoromethyl)pyrrol-1-yl]propyl]carbamate (PubChem CID 175520064) has the molecular formula C13H19F3N2O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-[2-(trifluoromethyl)pyrrol-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-[2-(trifluoromethyl)pyrrol-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 175520064 |
| Molecular Formula | C13H19F3N2O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | tert-butyl N-[(2R)-2-[2-(trifluoromethyl)pyrrol-1-yl]propyl]carbamate |
| SMILES | C[C@H](CNC(=O)OC(C)(C)C)n1cccc1C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2O2/c1-9(8-17-11(19)20-12(2,3)4)18-7-5-6-10(18)13(14,15)16/h5-7,9H,8H2,1-4H3,(H,17,19)/t9-/m1/s1 |
| InChIKey | BJJGGJZWUQKYJY-SECBINFHSA-N |
| XLogP | 3.59 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |