C12H19ClN2O2 — CID 175182745
tert-butyl N-[(2R)-2-(3-chloropyrrol-1-yl)propyl]carbamate (PubChem CID 175182745) has the molecular formula C12H19ClN2O2 and a molecular weight of 258.75 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-(3-chloropyrrol-1-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-(3-chloropyrrol-1-yl)propyl]carbamate |
|---|---|
| PubChem CID | 175182745 |
| Molecular Formula | C12H19ClN2O2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | tert-butyl N-[(2R)-2-(3-chloropyrrol-1-yl)propyl]carbamate |
| SMILES | C[C@H](CNC(=O)OC(C)(C)C)n1ccc(Cl)c1 |
| InChI | InChI=1S/C12H19ClN2O2/c1-9(15-6-5-10(13)8-15)7-14-11(16)17-12(2,3)4/h5-6,8-9H,7H2,1-4H3,(H,14,16)/t9-/m1/s1 |
| InChIKey | XFXALDWROWQAFK-SECBINFHSA-N |
| XLogP | 3.23 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |