C16H24N2O6 — CID 142336707
dimethyl 1-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]pyrrole-2,3-dicarboxylate (PubChem CID 142336707) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is dimethyl 1-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]pyrrole-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 142336707 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | dimethyl 1-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]pyrrole-2,3-dicarboxylate |
| SMILES | COC(=O)c1ccn([C@@H](C)CNC(=O)OC(C)(C)C)c1C(=O)OC |
| InChI | InChI=1S/C16H24N2O6/c1-10(9-17-15(21)24-16(2,3)4)18-8-7-11(13(19)22-5)12(18)14(20)23-6/h7-8,10H,9H2,1-6H3,(H,17,21)/t10-/m0/s1 |
| InChIKey | BXLAXOSMTATGRX-JTQLQIEISA-N |
| XLogP | 2.15 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|