About 5-(4,5-dihydroimidazol-1-yl)pentane-2-thiol
5-(4,5-dihydroimidazol-1-yl)pentane-2-thiol (PubChem CID 154936880) has the molecular formula C8H16N2S
and a molecular weight of 172.30 g/mol. Its IUPAC name is 5-(4,5-dihydroimidazol-1-yl)pentane-2-thiol.
Molecular Properties
| Compound Name | 5-(4,5-dihydroimidazol-1-yl)pentane-2-thiol |
| PubChem CID | 154936880 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 5-(4,5-dihydroimidazol-1-yl)pentane-2-thiol |
| SMILES | CC(S)CCCN1C=NCC1 |
| InChI | InChI=1S/C8H16N2S/c1-8(11)3-2-5-10-6-4-9-7-10/h7-8,11H,2-6H2,1H3 |
| InChIKey | GQZZPUYOQLNDHC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(4,5-dihydroimidazol-1-yl)pentane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,5-dihydroimidazol-1-yl)pentane-2-thiol?
The IUPAC name of 5-(4,5-dihydroimidazol-1-yl)pentane-2-thiol (CID 154936880) is 5-(4,5-dihydroimidazol-1-yl)pentane-2-thiol.
What is the SMILES notation for 5-(4,5-dihydroimidazol-1-yl)pentane-2-thiol?
The canonical SMILES for 5-(4,5-dihydroimidazol-1-yl)pentane-2-thiol is CC(S)CCCN1C=NCC1.
What is the InChIKey of 5-(4,5-dihydroimidazol-1-yl)pentane-2-thiol?
The InChIKey is GQZZPUYOQLNDHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S/c1-8(11)3-2-5-10-6-4-9-7-10/h7-8,11H,2-6H2,1H3.
What are the key properties of 5-(4,5-dihydroimidazol-1-yl)pentane-2-thiol?
5-(4,5-dihydroimidazol-1-yl)pentane-2-thiol has a molecular weight of 172.30 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,5-dihydroimidazol-1-yl)pentane-2-thiol is sourced from PubChem (CID 154936880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).