C6H12N2S — CID 173272070
1-(4,5-dihydroimidazol-1-yl)propane-1-thiol (PubChem CID 173272070) has the molecular formula C6H12N2S and a molecular weight of 144.24 g/mol. Its IUPAC name is 1-(4,5-dihydroimidazol-1-yl)propane-1-thiol.
| Compound Name | 1-(4,5-dihydroimidazol-1-yl)propane-1-thiol |
|---|---|
| PubChem CID | 173272070 |
| Molecular Formula | C6H12N2S |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 1-(4,5-dihydroimidazol-1-yl)propane-1-thiol |
| SMILES | CCC(S)N1C=NCC1 |
| InChI | InChI=1S/C6H12N2S/c1-2-6(9)8-4-3-7-5-8/h5-6,9H,2-4H2,1H3 |
| InChIKey | KJVGRSWGWWCEGH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|