C34H37N5O3S2 — CID 154937117
4-[1-[butyl(methyl)amino]-4-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)butan-2-yl]oxy-3-cyano-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 154937117) has the molecular formula C34H37N5O3S2 and a molecular weight of 627.84 g/mol. Its IUPAC name is 4-[1-[butyl(methyl)amino]-4-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)butan-2-yl]oxy-3-cyano-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 4-[1-[butyl(methyl)amino]-4-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)butan-2-yl]oxy-3-cyano-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 154937117 |
| Molecular Formula | C34H37N5O3S2 |
| Molecular Weight | 627.84 g/mol |
| Exact Mass | 627.23 |
| IUPAC Name | 4-[1-[butyl(methyl)amino]-4-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)butan-2-yl]oxy-3-cyano-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | CCCCN(C)CC(CCC12CCC(c3ccccc31)c1ccccc12)Oc1ccc(S(=O)(=O)Nc2ncns2)cc1C#N |
| InChI | InChI=1S/C34H37N5O3S2/c1-3-4-19-39(2)22-25(42-32-14-13-26(20-24(32)21-35)44(40,41)38-33-36-23-37-43-33)15-17-34-18-16-27(28-9-5-7-11-30(28)34)29-10-6-8-12-31(29)34/h5-14,20,23,25,27H,3-4,15-19,22H2,1-2H3,(H,36,37,38) |
| InChIKey | RRPPNXZUUDLEPM-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.84 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |