C9H15NO — CID 154937495
5-ethyl-8-oxa-5-azatricyclo[4.3.0.01,4]nonane (PubChem CID 154937495) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 5-ethyl-8-oxa-5-azatricyclo[4.3.0.01,4]nonane.
| Compound Name | 5-ethyl-8-oxa-5-azatricyclo[4.3.0.01,4]nonane |
|---|---|
| PubChem CID | 154937495 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 5-ethyl-8-oxa-5-azatricyclo[4.3.0.01,4]nonane |
| SMILES | CCN1C2CCC23COCC13 |
| InChI | InChI=1S/C9H15NO/c1-2-10-7-3-4-9(7)6-11-5-8(9)10/h7-8H,2-6H2,1H3 |
| InChIKey | SBLVESPRZXQXNJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |