C10H17N — CID 144519579
6-ethyl-6-azatricyclo[5.2.0.01,3]nonane (PubChem CID 144519579) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 6-ethyl-6-azatricyclo[5.2.0.01,3]nonane.
| Compound Name | 6-ethyl-6-azatricyclo[5.2.0.01,3]nonane |
|---|---|
| PubChem CID | 144519579 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 6-ethyl-6-azatricyclo[5.2.0.01,3]nonane |
| SMILES | CCN1CCC2CC23CCC13 |
| InChI | InChI=1S/C10H17N/c1-2-11-6-4-8-7-10(8)5-3-9(10)11/h8-9H,2-7H2,1H3 |
| InChIKey | UMYGPTOLVKXOCX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |