C10H18N2 — CID 174080593
(1R)-1-(6-azatricyclo[5.2.0.01,3]nonan-6-yl)ethanamine (PubChem CID 174080593) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (1R)-1-(6-azatricyclo[5.2.0.01,3]nonan-6-yl)ethanamine.
| Compound Name | (1R)-1-(6-azatricyclo[5.2.0.01,3]nonan-6-yl)ethanamine |
|---|---|
| PubChem CID | 174080593 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (1R)-1-(6-azatricyclo[5.2.0.01,3]nonan-6-yl)ethanamine |
| SMILES | C[C@H](N)N1CCC2CC23CCC13 |
| InChI | InChI=1S/C10H18N2/c1-7(11)12-5-3-8-6-10(8)4-2-9(10)12/h7-9H,2-6,11H2,1H3/t7-,8?,9?,10?/m1/s1 |
| InChIKey | OZOVCLSYWDFZCU-QVNBGCGHSA-N |
| XLogP | 1.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |