C57H38N4O — CID 154938698
3-[1-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-3-yl]-N,N-bis(4-phenylphenyl)aniline (PubChem CID 154938698) has the molecular formula C57H38N4O and a molecular weight of 794.96 g/mol. Its IUPAC name is 3-[1-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-3-yl]-N,N-bis(4-phenylphenyl)aniline.
| Compound Name | 3-[1-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-3-yl]-N,N-bis(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 154938698 |
| Molecular Formula | C57H38N4O |
| Molecular Weight | 794.96 g/mol |
| Exact Mass | 794.30 |
| IUPAC Name | 3-[1-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-3-yl]-N,N-bis(4-phenylphenyl)aniline |
| SMILES | c1ccc(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3cccc(-c4cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c5c(c4)oc4ccccc45)c3)cc2)cc1 |
| InChI | InChI=1S/C57H38N4O/c1-5-16-39(17-6-1)41-28-32-47(33-29-41)61(48-34-30-42(31-35-48)40-18-7-2-8-19-40)49-25-15-24-45(36-49)46-37-51(54-50-26-13-14-27-52(50)62-53(54)38-46)57-59-55(43-20-9-3-10-21-43)58-56(60-57)44-22-11-4-12-23-44/h1-38H |
| InChIKey | GGYYOOWQJFPTHP-UHFFFAOYSA-N |
| XLogP | 15.24 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.96 |
| LogP ≤ 5 | 15.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |