C51H34N4O — CID 176853817
1-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-phenyl-N-[3-(3-phenylphenyl)phenyl]dibenzofuran-3-amine (PubChem CID 176853817) has the molecular formula C51H34N4O and a molecular weight of 718.86 g/mol. Its IUPAC name is 1-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-phenyl-N-[3-(3-phenylphenyl)phenyl]dibenzofuran-3-amine.
| Compound Name | 1-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-phenyl-N-[3-(3-phenylphenyl)phenyl]dibenzofuran-3-amine |
|---|---|
| PubChem CID | 176853817 |
| Molecular Formula | C51H34N4O |
| Molecular Weight | 718.86 g/mol |
| Exact Mass | 718.27 |
| IUPAC Name | 1-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-phenyl-N-[3-(3-phenylphenyl)phenyl]dibenzofuran-3-amine |
| SMILES | c1ccc(-c2cccc(-c3cccc(N(c4ccccc4)c4cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c5c(c4)oc4ccccc45)c3)c2)cc1 |
| InChI | InChI=1S/C51H34N4O/c1-5-17-35(18-6-1)38-23-15-24-39(31-38)40-25-16-28-42(32-40)55(41-26-11-4-12-27-41)43-33-45(48-44-29-13-14-30-46(44)56-47(48)34-43)51-53-49(36-19-7-2-8-20-36)52-50(54-51)37-21-9-3-10-22-37/h1-34H |
| InChIKey | WKWNLBSLDMRZSB-UHFFFAOYSA-N |
| XLogP | 13.58 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.86 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |