C10H15NO3 — CID 154939696
2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid (PubChem CID 154939696) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid.
| Compound Name | 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid |
|---|---|
| PubChem CID | 154939696 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid |
| SMILES | CC/C(C)=C/C=C\N(C=O)CC(=O)O |
| InChI | InChI=1S/C10H15NO3/c1-3-9(2)5-4-6-11(8-12)7-10(13)14/h4-6,8H,3,7H2,1-2H3,(H,13,14)/b6-4-,9-5+ |
| InChIKey | WQCYKMPSJASXLW-QUNSIMLLSA-N |
| XLogP | 1.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|