About 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid
2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid (PubChem CID 154939696) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid |
| PubChem CID | 154939696 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid |
| SMILES | CC/C(C)=C/C=C\N(C=O)CC(=O)O |
| InChI | InChI=1S/C10H15NO3/c1-3-9(2)5-4-6-11(8-12)7-10(13)14/h4-6,8H,3,7H2,1-2H3,(H,13,14)/b6-4-,9-5+ |
| InChIKey | WQCYKMPSJASXLW-QUNSIMLLSA-N |
| XLogP | 1.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid?
The IUPAC name of 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid (CID 154939696) is 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid.
What is the SMILES notation for 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid?
The canonical SMILES for 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid is CC/C(C)=C/C=C\N(C=O)CC(=O)O.
What is the InChIKey of 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid?
The InChIKey is WQCYKMPSJASXLW-QUNSIMLLSA-N. The full InChI is InChI=1S/C10H15NO3/c1-3-9(2)5-4-6-11(8-12)7-10(13)14/h4-6,8H,3,7H2,1-2H3,(H,13,14)/b6-4-,9-5+.
What are the key properties of 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid?
2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid has a molecular weight of 197.23 g/mol, XLogP of 1.40, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[formyl-[(1Z,3E)-4-methylhexa-1,3-dienyl]amino]acetic acid is sourced from PubChem (CID 154939696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).