C17H26N4O2 — CID 154940011
4-N-[2-(dimethylamino)ethyl]-4-N-methyl-2-nitro-1-N,1-N-bis(prop-1-en-2-yl)benzene-1,4-diamine (PubChem CID 154940011) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-N-[2-(dimethylamino)ethyl]-4-N-methyl-2-nitro-1-N,1-N-bis(prop-1-en-2-yl)benzene-1,4-diamine.
| Compound Name | 4-N-[2-(dimethylamino)ethyl]-4-N-methyl-2-nitro-1-N,1-N-bis(prop-1-en-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 154940011 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 4-N-[2-(dimethylamino)ethyl]-4-N-methyl-2-nitro-1-N,1-N-bis(prop-1-en-2-yl)benzene-1,4-diamine |
| SMILES | C=C(C)N(C(=C)C)c1ccc(N(C)CCN(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N4O2/c1-13(2)20(14(3)4)16-9-8-15(12-17(16)21(22)23)19(7)11-10-18(5)6/h8-9,12H,1,3,10-11H2,2,4-7H3 |
| InChIKey | MQZQNRNFEREMHG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|