C18H34N4O3 — CID 145314408
N-[2-(dimethylamino)ethyl]-N'-(3-methoxy-4-nitrophenyl)-N,N'-dimethylpropane-1,3-diamine;ethane (PubChem CID 145314408) has the molecular formula C18H34N4O3 and a molecular weight of 354.50 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N'-(3-methoxy-4-nitrophenyl)-N,N'-dimethylpropane-1,3-diamine;ethane.
| Compound Name | N-[2-(dimethylamino)ethyl]-N'-(3-methoxy-4-nitrophenyl)-N,N'-dimethylpropane-1,3-diamine;ethane |
|---|---|
| PubChem CID | 145314408 |
| Molecular Formula | C18H34N4O3 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N'-(3-methoxy-4-nitrophenyl)-N,N'-dimethylpropane-1,3-diamine;ethane |
| SMILES | CC.COc1cc(N(C)CCCN(C)CCN(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H28N4O3.C2H6/c1-17(2)11-12-18(3)9-6-10-19(4)14-7-8-15(20(21)22)16(13-14)23-5;1-2/h7-8,13H,6,9-12H2,1-5H3;1-2H3 |
| InChIKey | CCUZTLGPUVXVRU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|