C29H32ClN7O8 — CID 154942507
methyl 3-[3-[3-[(E)-4-aminobut-2-enyl]-6-carbamoyl-2-[(4-ethyl-2-methyl-1,3-oxazol-5-yl)amino]benzimidazol-4-yl]oxypropoxy]-4-chloro-5-nitrobenzoate (PubChem CID 154942507) has the molecular formula C29H32ClN7O8 and a molecular weight of 642.07 g/mol. Its IUPAC name is methyl 3-[3-[3-[(E)-4-aminobut-2-enyl]-6-carbamoyl-2-[(4-ethyl-2-methyl-1,3-oxazol-5-yl)amino]benzimidazol-4-yl]oxypropoxy]-4-chloro-5-nitrobenzoate.
| Compound Name | methyl 3-[3-[3-[(E)-4-aminobut-2-enyl]-6-carbamoyl-2-[(4-ethyl-2-methyl-1,3-oxazol-5-yl)amino]benzimidazol-4-yl]oxypropoxy]-4-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 154942507 |
| Molecular Formula | C29H32ClN7O8 |
| Molecular Weight | 642.07 g/mol |
| Exact Mass | 641.20 |
| IUPAC Name | methyl 3-[3-[3-[(E)-4-aminobut-2-enyl]-6-carbamoyl-2-[(4-ethyl-2-methyl-1,3-oxazol-5-yl)amino]benzimidazol-4-yl]oxypropoxy]-4-chloro-5-nitrobenzoate |
| SMILES | CCc1nc(C)oc1Nc1nc2cc(C(N)=O)cc(OCCCOc3cc(C(=O)OC)cc([N+](=O)[O-])c3Cl)c2n1C/C=C/CN |
| InChI | InChI=1S/C29H32ClN7O8/c1-4-19-27(45-16(2)33-19)35-29-34-20-12-17(26(32)38)14-23(25(20)36(29)9-6-5-8-31)44-11-7-10-43-22-15-18(28(39)42-3)13-21(24(22)30)37(40)41/h5-6,12-15H,4,7-11,31H2,1-3H3,(H2,32,38)(H,34,35)/b6-5+ |
| InChIKey | ALFGTHMCAGRMGG-AATRIKPKSA-N |
| XLogP | 4.45 |
| TPSA | 212.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.07 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|