C16H12BrClF4INO2 — CID 154943236
5-[2-[(2-bromo-4-chloro-3-fluorophenyl)methyl]-3,3,3-trifluoropropoxy]-4-iodo-2-methoxypyridine (PubChem CID 154943236) has the molecular formula C16H12BrClF4INO2 and a molecular weight of 568.53 g/mol. Its IUPAC name is 5-[2-[(2-bromo-4-chloro-3-fluorophenyl)methyl]-3,3,3-trifluoropropoxy]-4-iodo-2-methoxypyridine.
| Compound Name | 5-[2-[(2-bromo-4-chloro-3-fluorophenyl)methyl]-3,3,3-trifluoropropoxy]-4-iodo-2-methoxypyridine |
|---|---|
| PubChem CID | 154943236 |
| Molecular Formula | C16H12BrClF4INO2 |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 566.87 |
| IUPAC Name | 5-[2-[(2-bromo-4-chloro-3-fluorophenyl)methyl]-3,3,3-trifluoropropoxy]-4-iodo-2-methoxypyridine |
| SMILES | COc1cc(I)c(OCC(Cc2ccc(Cl)c(F)c2Br)C(F)(F)F)cn1 |
| InChI | InChI=1S/C16H12BrClF4INO2/c1-25-13-5-11(23)12(6-24-13)26-7-9(16(20,21)22)4-8-2-3-10(18)15(19)14(8)17/h2-3,5-6,9H,4,7H2,1H3 |
| InChIKey | YJUTYHGHIXAPGM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|