About 4-(3-chloro-2-fluorophenyl)-2,5-dimethoxypyridine
4-(3-chloro-2-fluorophenyl)-2,5-dimethoxypyridine (PubChem CID 175182286) has the molecular formula C13H11ClFNO2
and a molecular weight of 267.69 g/mol. Its IUPAC name is 4-(3-chloro-2-fluorophenyl)-2,5-dimethoxypyridine.
Molecular Properties
| Compound Name | 4-(3-chloro-2-fluorophenyl)-2,5-dimethoxypyridine |
| PubChem CID | 175182286 |
| Molecular Formula | C13H11ClFNO2 |
| Molecular Weight | 267.69 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 4-(3-chloro-2-fluorophenyl)-2,5-dimethoxypyridine |
| SMILES | COc1cc(-c2cccc(Cl)c2F)c(OC)cn1 |
| InChI | InChI=1S/C13H11ClFNO2/c1-17-11-7-16-12(18-2)6-9(11)8-4-3-5-10(14)13(8)15/h3-7H,1-2H3 |
| InChIKey | RXVRQQWOUGDMJC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.69 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-chloro-2-fluorophenyl)-2,5-dimethoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloro-2-fluorophenyl)-2,5-dimethoxypyridine?
The IUPAC name of 4-(3-chloro-2-fluorophenyl)-2,5-dimethoxypyridine (CID 175182286) is 4-(3-chloro-2-fluorophenyl)-2,5-dimethoxypyridine.
What is the SMILES notation for 4-(3-chloro-2-fluorophenyl)-2,5-dimethoxypyridine?
The canonical SMILES for 4-(3-chloro-2-fluorophenyl)-2,5-dimethoxypyridine is COc1cc(-c2cccc(Cl)c2F)c(OC)cn1.
What is the InChIKey of 4-(3-chloro-2-fluorophenyl)-2,5-dimethoxypyridine?
The InChIKey is RXVRQQWOUGDMJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClFNO2/c1-17-11-7-16-12(18-2)6-9(11)8-4-3-5-10(14)13(8)15/h3-7H,1-2H3.
What are the key properties of 4-(3-chloro-2-fluorophenyl)-2,5-dimethoxypyridine?
4-(3-chloro-2-fluorophenyl)-2,5-dimethoxypyridine has a molecular weight of 267.69 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloro-2-fluorophenyl)-2,5-dimethoxypyridine is sourced from PubChem (CID 175182286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).