C15H14ClNO3 — CID 134323813
1-[4-chloro-2-(2,5-dimethoxy-4-pyridinyl)phenyl]ethanone (PubChem CID 134323813) has the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. Its IUPAC name is 1-[4-chloro-2-(2,5-dimethoxy-4-pyridinyl)phenyl]ethanone.
| Compound Name | 1-[4-chloro-2-(2,5-dimethoxy-4-pyridinyl)phenyl]ethanone |
|---|---|
| PubChem CID | 134323813 |
| Molecular Formula | C15H14ClNO3 |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 1-[4-chloro-2-(2,5-dimethoxy-4-pyridinyl)phenyl]ethanone |
| SMILES | COc1cc(-c2cc(Cl)ccc2C(C)=O)c(OC)cn1 |
| InChI | InChI=1S/C15H14ClNO3/c1-9(18)11-5-4-10(16)6-12(11)13-7-15(20-3)17-8-14(13)19-2/h4-8H,1-3H3 |
| InChIKey | VOKAEJLSRIKUBB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |