C27H26N4S2 — CID 154944652
pyridin-3-ylmethyl N,N-bis[2-(1H-indol-3-yl)ethyl]carbamodithioate (PubChem CID 154944652) has the molecular formula C27H26N4S2 and a molecular weight of 470.67 g/mol. Its IUPAC name is pyridin-3-ylmethyl N,N-bis[2-(1H-indol-3-yl)ethyl]carbamodithioate.
| Compound Name | pyridin-3-ylmethyl N,N-bis[2-(1H-indol-3-yl)ethyl]carbamodithioate |
|---|---|
| PubChem CID | 154944652 |
| Molecular Formula | C27H26N4S2 |
| Molecular Weight | 470.67 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | pyridin-3-ylmethyl N,N-bis[2-(1H-indol-3-yl)ethyl]carbamodithioate |
| SMILES | S=C(SCc1cccnc1)N(CCc1c[nH]c2ccccc12)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H26N4S2/c32-27(33-19-20-6-5-13-28-16-20)31(14-11-21-17-29-25-9-3-1-7-23(21)25)15-12-22-18-30-26-10-4-2-8-24(22)26/h1-10,13,16-18,29-30H,11-12,14-15,19H2 |
| InChIKey | LNWNOFJZNSHAHR-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.67 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|