C14H15NS — CID 15494569
1-cyclopenta-2,4-dien-1-yl-N-(2-phenylsulfanylethyl)methanimine (PubChem CID 15494569) has the molecular formula C14H15NS and a molecular weight of 229.35 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-N-(2-phenylsulfanylethyl)methanimine.
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-N-(2-phenylsulfanylethyl)methanimine |
|---|---|
| PubChem CID | 15494569 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-N-(2-phenylsulfanylethyl)methanimine |
| SMILES | C1=CC(/C=N/CCSc2ccccc2)C=C1 |
| InChI | InChI=1S/C14H15NS/c1-2-8-14(9-3-1)16-11-10-15-12-13-6-4-5-7-13/h1-9,12-13H,10-11H2/b15-12+ |
| InChIKey | CJHCZFARDSOFPQ-NTCAYCPXSA-N |
| XLogP | 3.59 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|