C23H20FN7O2 — CID 154946379
[2-(5-fluoro-3-pyridinyl)-4-(2,3,4,9-tetrahydro-1H-carbazol-3-ylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methanediol (PubChem CID 154946379) has the molecular formula C23H20FN7O2 and a molecular weight of 445.46 g/mol. Its IUPAC name is [2-(5-fluoro-3-pyridinyl)-4-(2,3,4,9-tetrahydro-1H-carbazol-3-ylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methanediol.
| Compound Name | [2-(5-fluoro-3-pyridinyl)-4-(2,3,4,9-tetrahydro-1H-carbazol-3-ylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methanediol |
|---|---|
| PubChem CID | 154946379 |
| Molecular Formula | C23H20FN7O2 |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [2-(5-fluoro-3-pyridinyl)-4-(2,3,4,9-tetrahydro-1H-carbazol-3-ylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methanediol |
| SMILES | OC(O)c1cnn2c(NC3CCc4[nH]c5ccccc5c4C3)nc(-c3cncc(F)c3)nc12 |
| InChI | InChI=1S/C23H20FN7O2/c24-13-7-12(9-25-10-13)20-29-21-17(22(32)33)11-26-31(21)23(30-20)27-14-5-6-19-16(8-14)15-3-1-2-4-18(15)28-19/h1-4,7,9-11,14,22,28,32-33H,5-6,8H2,(H,27,29,30) |
| InChIKey | IEUBXMXYKMYZLO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 124.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|