C27H26FN7Si — CID 156784471
(3R)-N-[2-(5-fluoro-3-pyridinyl)-8-(2-trimethylsilylethynyl)pyrazolo[1,5-a][1,3,5]triazin-4-yl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine (PubChem CID 156784471) has the molecular formula C27H26FN7Si and a molecular weight of 495.64 g/mol. Its IUPAC name is (3R)-N-[2-(5-fluoro-3-pyridinyl)-8-(2-trimethylsilylethynyl)pyrazolo[1,5-a][1,3,5]triazin-4-yl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine.
| Compound Name | (3R)-N-[2-(5-fluoro-3-pyridinyl)-8-(2-trimethylsilylethynyl)pyrazolo[1,5-a][1,3,5]triazin-4-yl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 156784471 |
| Molecular Formula | C27H26FN7Si |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | (3R)-N-[2-(5-fluoro-3-pyridinyl)-8-(2-trimethylsilylethynyl)pyrazolo[1,5-a][1,3,5]triazin-4-yl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| SMILES | C[Si](C)(C)C#Cc1cnn2c(N[C@@H]3CCc4[nH]c5ccccc5c4C3)nc(-c3cncc(F)c3)nc12 |
| InChI | InChI=1S/C27H26FN7Si/c1-36(2,3)11-10-17-15-30-35-26(17)33-25(18-12-19(28)16-29-14-18)34-27(35)31-20-8-9-24-22(13-20)21-6-4-5-7-23(21)32-24/h4-7,12,14-16,20,32H,8-9,13H2,1-3H3,(H,31,33,34)/t20-/m1/s1 |
| InChIKey | OTUPDHPUOLUHMN-HXUWFJFHSA-N |
| XLogP | 5.01 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|