C13H17N3O — CID 154947058
7-cyclohexyl-4-methoxypyrrolo[2,3-d]pyrimidine (PubChem CID 154947058) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 7-cyclohexyl-4-methoxypyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-cyclohexyl-4-methoxypyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 154947058 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 7-cyclohexyl-4-methoxypyrrolo[2,3-d]pyrimidine |
| SMILES | COc1ncnc2c1ccn2C1CCCCC1 |
| InChI | InChI=1S/C13H17N3O/c1-17-13-11-7-8-16(12(11)14-9-15-13)10-5-3-2-4-6-10/h7-10H,2-6H2,1H3 |
| InChIKey | FAWZGTBISSGBEO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |